C17H17FO2 — CID 138963771
(2S,3R)-2-ethoxy-3-(4-fluorophenyl)-3,4-dihydro-2H-chromene (PubChem CID 138963771) has the molecular formula C17H17FO2 and a molecular weight of 272.32 g/mol. Its IUPAC name is (2S,3R)-2-ethoxy-3-(4-fluorophenyl)-3,4-dihydro-2H-chromene.
| Compound Name | (2S,3R)-2-ethoxy-3-(4-fluorophenyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 138963771 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (2S,3R)-2-ethoxy-3-(4-fluorophenyl)-3,4-dihydro-2H-chromene |
| SMILES | CCO[C@H]1Oc2ccccc2C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FO2/c1-2-19-17-15(12-7-9-14(18)10-8-12)11-13-5-3-4-6-16(13)20-17/h3-10,15,17H,2,11H2,1H3/t15-,17+/m1/s1 |
| InChIKey | TVMIYHGNUFYJES-WBVHZDCISA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |