C8H6NO2S- — CID 138967916
3-methylidene-1,2-benzothiazol-2-ide 1,1-dioxide (PubChem CID 138967916) has the molecular formula C8H6NO2S- and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-methylidene-1,2-benzothiazol-2-ide 1,1-dioxide.
| Compound Name | 3-methylidene-1,2-benzothiazol-2-ide 1,1-dioxide |
|---|---|
| PubChem CID | 138967916 |
| Molecular Formula | C8H6NO2S- |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 3-methylidene-1,2-benzothiazol-2-ide 1,1-dioxide |
| SMILES | C=C1[N-]S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C8H6NO2S/c1-6-7-4-2-3-5-8(7)12(10,11)9-6/h2-5H,1H2/q-1 |
| InChIKey | YAEZGVYLUVYIFQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |