About calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one
calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one (PubChem CID 23719498) has the molecular formula C7H4CaNNaO3S+2
and a molecular weight of 245.25 g/mol. Its IUPAC name is calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one.
Molecular Properties
| Compound Name | calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one |
| PubChem CID | 23719498 |
| Molecular Formula | C7H4CaNNaO3S+2 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 244.94 |
| IUPAC Name | calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one |
| SMILES | O=C1[N-]S(=O)(=O)c2ccccc21.[Ca+2].[Na+] |
| InChI | InChI=1S/C7H5NO3S.Ca.Na/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;;/h1-4H,(H,8,9);;/q;+2;+1/p-1 |
| InChIKey | KKMYDFMRRMIGOU-UHFFFAOYSA-M |
| XLogP | -2.47 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one?
The IUPAC name of calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one (CID 23719498) is calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one.
What is the SMILES notation for calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one?
The canonical SMILES for calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one is O=C1[N-]S(=O)(=O)c2ccccc21.[Ca+2].[Na+].
What is the InChIKey of calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one?
The InChIKey is KKMYDFMRRMIGOU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5NO3S.Ca.Na/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;;/h1-4H,(H,8,9);;/q;+2;+1/p-1.
What are the key properties of calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one?
calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one has a molecular weight of 245.25 g/mol, XLogP of -2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;sodium;1,1-dioxo-1,2-benzothiazol-2-id-3-one is sourced from PubChem (CID 23719498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).