C30H18N4O4S4Zn — CID 135462979
zinc bis((3Z)-3-(1,3-benzothiazol-2-ylmethylidene)-1,2-benzothiazol-2-ide 1,1-dioxide) (PubChem CID 135462979) has the molecular formula C30H18N4O4S4Zn and a molecular weight of 692.16 g/mol. Its IUPAC name is zinc bis((3Z)-3-(1,3-benzothiazol-2-ylmethylidene)-1,2-benzothiazol-2-ide 1,1-dioxide).
| Compound Name | zinc bis((3Z)-3-(1,3-benzothiazol-2-ylmethylidene)-1,2-benzothiazol-2-ide 1,1-dioxide) |
|---|---|
| PubChem CID | 135462979 |
| Molecular Formula | C30H18N4O4S4Zn |
| Molecular Weight | 692.16 g/mol |
| Exact Mass | 689.95 |
| IUPAC Name | zinc bis((3Z)-3-(1,3-benzothiazol-2-ylmethylidene)-1,2-benzothiazol-2-ide 1,1-dioxide) |
| SMILES | O=S1(=O)[N-]/C(=C\c2nc3ccccc3s2)c2ccccc21.O=S1(=O)[N-]/C(=C\c2nc3ccccc3s2)c2ccccc21.[Zn+2] |
| InChI | InChI=1S/2C15H9N2O2S2.Zn/c2*18-21(19)14-8-4-1-5-10(14)12(17-21)9-15-16-11-6-2-3-7-13(11)20-15;/h2*1-9H;/q2*-1;+2/b2*12-9-; |
| InChIKey | SMEMINNLWIRYCA-PIQLPZBWSA-N |
| XLogP | 7.74 |
| TPSA | 122.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.16 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|