C19H13N3O4S2 — CID 2384628
(2Z)-2-(1,3-benzothiazol-2-ylmethylidene)-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidin-4-one (PubChem CID 2384628) has the molecular formula C19H13N3O4S2 and a molecular weight of 411.46 g/mol. Its IUPAC name is (2Z)-2-(1,3-benzothiazol-2-ylmethylidene)-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-(1,3-benzothiazol-2-ylmethylidene)-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2384628 |
| Molecular Formula | C19H13N3O4S2 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | (2Z)-2-(1,3-benzothiazol-2-ylmethylidene)-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-thiazolidin-4-one |
| SMILES | O=C(CN1C(=O)CS/C1=C\c1nc2ccccc2s1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H13N3O4S2/c23-15(12-5-7-13(8-6-12)22(25)26)10-21-18(24)11-27-19(21)9-17-20-14-3-1-2-4-16(14)28-17/h1-9H,10-11H2/b19-9- |
| InChIKey | GYJLVEXRJPLIFC-OCKHKDLRSA-N |
| XLogP | 3.96 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|