C19H26O4S — CID 138971433
ethyl 3-[1-[(E)-2-(benzenesulfonyl)ethenyl]cyclohexyl]propanoate (PubChem CID 138971433) has the molecular formula C19H26O4S and a molecular weight of 350.48 g/mol. Its IUPAC name is ethyl 3-[1-[(E)-2-(benzenesulfonyl)ethenyl]cyclohexyl]propanoate.
| Compound Name | ethyl 3-[1-[(E)-2-(benzenesulfonyl)ethenyl]cyclohexyl]propanoate |
|---|---|
| PubChem CID | 138971433 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | ethyl 3-[1-[(E)-2-(benzenesulfonyl)ethenyl]cyclohexyl]propanoate |
| SMILES | CCOC(=O)CCC1(/C=C/S(=O)(=O)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H26O4S/c1-2-23-18(20)11-14-19(12-7-4-8-13-19)15-16-24(21,22)17-9-5-3-6-10-17/h3,5-6,9-10,15-16H,2,4,7-8,11-14H2,1H3/b16-15+ |
| InChIKey | GGWRDFOWLOGQJI-FOCLMDBBSA-N |
| XLogP | 4.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |