C22H16F2N+ — CID 138972330
2-(3,5-difluorophenyl)-4-methyl-3-phenylisoquinolin-2-ium (PubChem CID 138972330) has the molecular formula C22H16F2N+ and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-4-methyl-3-phenylisoquinolin-2-ium.
| Compound Name | 2-(3,5-difluorophenyl)-4-methyl-3-phenylisoquinolin-2-ium |
|---|---|
| PubChem CID | 138972330 |
| Molecular Formula | C22H16F2N+ |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-(3,5-difluorophenyl)-4-methyl-3-phenylisoquinolin-2-ium |
| SMILES | Cc1c(-c2ccccc2)[n+](-c2cc(F)cc(F)c2)cc2ccccc12 |
| InChI | InChI=1S/C22H16F2N/c1-15-21-10-6-5-9-17(21)14-25(20-12-18(23)11-19(24)13-20)22(15)16-7-3-2-4-8-16/h2-14H,1H3/q+1 |
| InChIKey | CAQKCKJEQBLBDO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|