C26H28BrNO6S — CID 139038805
diethyl (2E)-2-[(2E)-2-(4-bromophenyl)-2-(4-methylphenyl)sulfonyliminoethylidene]-5-methylidenehexanedioate (PubChem CID 139038805) has the molecular formula C26H28BrNO6S and a molecular weight of 562.48 g/mol. Its IUPAC name is diethyl (2E)-2-[(2E)-2-(4-bromophenyl)-2-(4-methylphenyl)sulfonyliminoethylidene]-5-methylidenehexanedioate.
| Compound Name | diethyl (2E)-2-[(2E)-2-(4-bromophenyl)-2-(4-methylphenyl)sulfonyliminoethylidene]-5-methylidenehexanedioate |
|---|---|
| PubChem CID | 139038805 |
| Molecular Formula | C26H28BrNO6S |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | diethyl (2E)-2-[(2E)-2-(4-bromophenyl)-2-(4-methylphenyl)sulfonyliminoethylidene]-5-methylidenehexanedioate |
| SMILES | C=C(CC/C(=C\C(=N/S(=O)(=O)c1ccc(C)cc1)c1ccc(Br)cc1)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C26H28BrNO6S/c1-5-33-25(29)19(4)9-10-21(26(30)34-6-2)17-24(20-11-13-22(27)14-12-20)28-35(31,32)23-15-7-18(3)8-16-23/h7-8,11-17H,4-6,9-10H2,1-3H3/b21-17+,28-24+ |
| InChIKey | GRADMWUGZVTBEF-MRGNUWOCSA-N |
| XLogP | 5.32 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|