C22H27Cl2NO4S — CID 139039726
dichloromethane;(3S,4S)-4-[(1S,2R)-1-hydroxy-1-phenylbut-3-en-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol (PubChem CID 139039726) has the molecular formula C22H27Cl2NO4S and a molecular weight of 472.43 g/mol. Its IUPAC name is dichloromethane;(3S,4S)-4-[(1S,2R)-1-hydroxy-1-phenylbut-3-en-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | dichloromethane;(3S,4S)-4-[(1S,2R)-1-hydroxy-1-phenylbut-3-en-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 139039726 |
| Molecular Formula | C22H27Cl2NO4S |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | dichloromethane;(3S,4S)-4-[(1S,2R)-1-hydroxy-1-phenylbut-3-en-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidin-3-ol |
| SMILES | C=C[C@H]([C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C[C@H]1O)[C@H](O)c1ccccc1.ClCCl |
| InChI | InChI=1S/C21H25NO4S.CH2Cl2/c1-3-18(21(24)16-7-5-4-6-8-16)19-13-22(14-20(19)23)27(25,26)17-11-9-15(2)10-12-17;2-1-3/h3-12,18-21,23-24H,1,13-14H2,2H3;1H2/t18-,19-,20-,21-;/m1./s1 |
| InChIKey | AVIXRELOPHDIFX-VGPSFVGCSA-N |
| XLogP | 3.93 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|