C29H40BrNO5S — CID 139050247
(2Z)-4-(4-bromophenyl)sulfonyl-6,6,10,10,14,14-hexamethyl-2-phenyl-1,8,12-trioxa-4-azacyclopentadec-2-ene (PubChem CID 139050247) has the molecular formula C29H40BrNO5S and a molecular weight of 594.61 g/mol. Its IUPAC name is (2Z)-4-(4-bromophenyl)sulfonyl-6,6,10,10,14,14-hexamethyl-2-phenyl-1,8,12-trioxa-4-azacyclopentadec-2-ene.
| Compound Name | (2Z)-4-(4-bromophenyl)sulfonyl-6,6,10,10,14,14-hexamethyl-2-phenyl-1,8,12-trioxa-4-azacyclopentadec-2-ene |
|---|---|
| PubChem CID | 139050247 |
| Molecular Formula | C29H40BrNO5S |
| Molecular Weight | 594.61 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | (2Z)-4-(4-bromophenyl)sulfonyl-6,6,10,10,14,14-hexamethyl-2-phenyl-1,8,12-trioxa-4-azacyclopentadec-2-ene |
| SMILES | CC1(C)COCC(C)(C)CO/C(c2ccccc2)=C\N(S(=O)(=O)c2ccc(Br)cc2)CC(C)(C)COC1 |
| InChI | InChI=1S/C29H40BrNO5S/c1-27(2)17-31(37(32,33)25-14-12-24(30)13-15-25)16-26(23-10-8-7-9-11-23)36-22-29(5,6)21-35-20-28(3,4)19-34-18-27/h7-16H,17-22H2,1-6H3/b26-16- |
| InChIKey | OMVWRMKWWJSLGH-QQXSKIMKSA-N |
| XLogP | 6.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.61 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |