C41H42N2O2Si — CID 139050924
(3aR,5aR,10bS,10cR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(1H-indol-3-ylmethyl)-2,3a,5a,6,10b,10c-hexahydro-1H-cyclopenta[c]carbazol-3-one (PubChem CID 139050924) has the molecular formula C41H42N2O2Si and a molecular weight of 622.89 g/mol. Its IUPAC name is (3aR,5aR,10bS,10cR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(1H-indol-3-ylmethyl)-2,3a,5a,6,10b,10c-hexahydro-1H-cyclopenta[c]carbazol-3-one.
| Compound Name | (3aR,5aR,10bS,10cR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(1H-indol-3-ylmethyl)-2,3a,5a,6,10b,10c-hexahydro-1H-cyclopenta[c]carbazol-3-one |
|---|---|
| PubChem CID | 139050924 |
| Molecular Formula | C41H42N2O2Si |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | (3aR,5aR,10bS,10cR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(1H-indol-3-ylmethyl)-2,3a,5a,6,10b,10c-hexahydro-1H-cyclopenta[c]carbazol-3-one |
| SMILES | CC(C)(C)[Si](OCC1=C(Cc2c[nH]c3ccccc23)[C@@H]2Nc3ccccc3[C@@H]2[C@H]2CCC(=O)[C@@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H42N2O2Si/c1-41(2,3)46(28-14-6-4-7-15-28,29-16-8-5-9-17-29)45-26-34-33(24-27-25-42-35-20-12-10-18-30(27)35)40-39(32-22-23-37(44)38(32)34)31-19-11-13-21-36(31)43-40/h4-21,25,32,38-40,42-43H,22-24,26H2,1-3H3/t32-,38+,39+,40-/m0/s1 |
| InChIKey | SACUWTCJDPMFGS-GDGOFKQLSA-N |
| XLogP | 7.77 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|