C21H22BBrN2O3 — CID 139066434
methanol;methoxy-[2-(4,7-phenanthrolin-4-ium-4-ylmethyl)phenyl]borinic acid;bromide (PubChem CID 139066434) has the molecular formula C21H22BBrN2O3 and a molecular weight of 441.13 g/mol. Its IUPAC name is methanol;methoxy-[2-(4,7-phenanthrolin-4-ium-4-ylmethyl)phenyl]borinic acid;bromide.
| Compound Name | methanol;methoxy-[2-(4,7-phenanthrolin-4-ium-4-ylmethyl)phenyl]borinic acid;bromide |
|---|---|
| PubChem CID | 139066434 |
| Molecular Formula | C21H22BBrN2O3 |
| Molecular Weight | 441.13 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | methanol;methoxy-[2-(4,7-phenanthrolin-4-ium-4-ylmethyl)phenyl]borinic acid;bromide |
| SMILES | CO.COB(O)c1ccccc1C[n+]1cccc2c3cccnc3ccc21.[Br-] |
| InChI | InChI=1S/C20H18BN2O2.CH4O.BrH/c1-25-21(24)18-9-3-2-6-15(18)14-23-13-5-8-17-16-7-4-12-22-19(16)10-11-20(17)23;1-2;/h2-13,24H,14H2,1H3;2H,1H3;1H/q+1;;/p-1 |
| InChIKey | WXVAMYYUNZVAKP-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 66.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.13 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|