C28H22CuN2O6 — CID 139073253
copper;2,9-dimethyl-1,10-phenanthroline;bis(3-hydroxybenzoate) (PubChem CID 139073253) has the molecular formula C28H22CuN2O6 and a molecular weight of 546.04 g/mol. Its IUPAC name is copper;2,9-dimethyl-1,10-phenanthroline;bis(3-hydroxybenzoate).
| Compound Name | copper;2,9-dimethyl-1,10-phenanthroline;bis(3-hydroxybenzoate) |
|---|---|
| PubChem CID | 139073253 |
| Molecular Formula | C28H22CuN2O6 |
| Molecular Weight | 546.04 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | copper;2,9-dimethyl-1,10-phenanthroline;bis(3-hydroxybenzoate) |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.O=C([O-])c1cccc(O)c1.O=C([O-])c1cccc(O)c1.[Cu+2] |
| InChI | InChI=1S/C14H12N2.2C7H6O3.Cu/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;2*8-6-3-1-2-5(4-6)7(9)10;/h3-8H,1-2H3;2*1-4,8H,(H,9,10);/q;;;+2/p-2 |
| InChIKey | SPLRBKPOLWZCPN-UHFFFAOYSA-L |
| XLogP | 2.91 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.04 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|