C13H20Cl3N2O4P — CID 139073451
benzyl(propan-2-yl)azanium;methoxy-[(2,2,2-trichloroacetyl)amino]phosphinate (PubChem CID 139073451) has the molecular formula C13H20Cl3N2O4P and a molecular weight of 405.65 g/mol. Its IUPAC name is benzyl(propan-2-yl)azanium;methoxy-[(2,2,2-trichloroacetyl)amino]phosphinate.
| Compound Name | benzyl(propan-2-yl)azanium;methoxy-[(2,2,2-trichloroacetyl)amino]phosphinate |
|---|---|
| PubChem CID | 139073451 |
| Molecular Formula | C13H20Cl3N2O4P |
| Molecular Weight | 405.65 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | benzyl(propan-2-yl)azanium;methoxy-[(2,2,2-trichloroacetyl)amino]phosphinate |
| SMILES | CC(C)[NH2+]Cc1ccccc1.COP(=O)([O-])NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H15N.C3H5Cl3NO4P/c1-9(2)11-8-10-6-4-3-5-7-10;1-11-12(9,10)7-2(8)3(4,5)6/h3-7,9,11H,8H2,1-2H3;1H3,(H2,7,8,9,10) |
| InChIKey | MMDSRZQUUDMKGB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.65 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|