C17H17Cl4N2O2+ — CID 3468159
benzyl-[2,2,2-trichloro-1-[(2-chlorophenyl)methoxycarbonylamino]ethyl]azanium (PubChem CID 3468159) has the molecular formula C17H17Cl4N2O2+ and a molecular weight of 423.15 g/mol. Its IUPAC name is benzyl-[2,2,2-trichloro-1-[(2-chlorophenyl)methoxycarbonylamino]ethyl]azanium.
| Compound Name | benzyl-[2,2,2-trichloro-1-[(2-chlorophenyl)methoxycarbonylamino]ethyl]azanium |
|---|---|
| PubChem CID | 3468159 |
| Molecular Formula | C17H17Cl4N2O2+ |
| Molecular Weight | 423.15 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | benzyl-[2,2,2-trichloro-1-[(2-chlorophenyl)methoxycarbonylamino]ethyl]azanium |
| SMILES | O=C(NC([NH2+]Cc1ccccc1)C(Cl)(Cl)Cl)OCc1ccccc1Cl |
| InChI | InChI=1S/C17H16Cl4N2O2/c18-14-9-5-4-8-13(14)11-25-16(24)23-15(17(19,20)21)22-10-12-6-2-1-3-7-12/h1-9,15,22H,10-11H2,(H,23,24)/p+1 |
| InChIKey | FVRVXUPKTDFHIC-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|