C19H22Cl6N4O+2 — CID 7037245
benzyl-[(1R)-1-[[(1R)-1-(benzylazaniumyl)-2,2,2-trichloroethyl]carbamoylamino]-2,2,2-trichloroethyl]azanium (PubChem CID 7037245) has the molecular formula C19H22Cl6N4O+2 and a molecular weight of 535.13 g/mol. Its IUPAC name is benzyl-[(1R)-1-[[(1R)-1-(benzylazaniumyl)-2,2,2-trichloroethyl]carbamoylamino]-2,2,2-trichloroethyl]azanium.
| Compound Name | benzyl-[(1R)-1-[[(1R)-1-(benzylazaniumyl)-2,2,2-trichloroethyl]carbamoylamino]-2,2,2-trichloroethyl]azanium |
|---|---|
| PubChem CID | 7037245 |
| Molecular Formula | C19H22Cl6N4O+2 |
| Molecular Weight | 535.13 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | benzyl-[(1R)-1-[[(1R)-1-(benzylazaniumyl)-2,2,2-trichloroethyl]carbamoylamino]-2,2,2-trichloroethyl]azanium |
| SMILES | O=C(N[C@H]([NH2+]Cc1ccccc1)C(Cl)(Cl)Cl)N[C@H]([NH2+]Cc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H20Cl6N4O/c20-18(21,22)15(26-11-13-7-3-1-4-8-13)28-17(30)29-16(19(23,24)25)27-12-14-9-5-2-6-10-14/h1-10,15-16,26-27H,11-12H2,(H2,28,29,30)/p+2/t15-,16-/m0/s1 |
| InChIKey | NMPFCLPMXJQBHV-HOTGVXAUSA-P |
| XLogP | 3.21 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|