C12H18Cl3N3O+2 — CID 4744050
pyridin-1-ium-3-ylmethyl-[2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]azanium (PubChem CID 4744050) has the molecular formula C12H18Cl3N3O+2 and a molecular weight of 326.66 g/mol. Its IUPAC name is pyridin-1-ium-3-ylmethyl-[2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]azanium.
| Compound Name | pyridin-1-ium-3-ylmethyl-[2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 4744050 |
| Molecular Formula | C12H18Cl3N3O+2 |
| Molecular Weight | 326.66 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | pyridin-1-ium-3-ylmethyl-[2,2,2-trichloro-1-(2-methylpropanoylamino)ethyl]azanium |
| SMILES | CC(C)C(=O)NC([NH2+]Cc1ccc[nH+]c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H16Cl3N3O/c1-8(2)10(19)18-11(12(13,14)15)17-7-9-4-3-5-16-6-9/h3-6,8,11,17H,7H2,1-2H3,(H,18,19)/p+2 |
| InChIKey | DTNVRUTVMOPKLV-UHFFFAOYSA-P |
| XLogP | 1.03 |
| TPSA | 59.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.66 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|