C28H27Cl3NO4P2+ — CID 126957728
tetraphenylphosphanium;2,2,2-trichloro-N-dimethoxyphosphorylacetamide (PubChem CID 126957728) has the molecular formula C28H27Cl3NO4P2+ and a molecular weight of 609.83 g/mol. Its IUPAC name is tetraphenylphosphanium;2,2,2-trichloro-N-dimethoxyphosphorylacetamide.
| Compound Name | tetraphenylphosphanium;2,2,2-trichloro-N-dimethoxyphosphorylacetamide |
|---|---|
| PubChem CID | 126957728 |
| Molecular Formula | C28H27Cl3NO4P2+ |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 608.05 |
| IUPAC Name | tetraphenylphosphanium;2,2,2-trichloro-N-dimethoxyphosphorylacetamide |
| SMILES | COP(=O)(NC(=O)C(Cl)(Cl)Cl)OC.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.C4H7Cl3NO4P/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-11-13(10,12-2)8-3(9)4(5,6)7/h1-20H;1-2H3,(H,8,9,10)/q+1; |
| InChIKey | FFYRLKLSSKKHAY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|