C52H48N4O8+4 — CID 139073799
5,10,15,20-tetrakis(2,6-dimethoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium (PubChem CID 139073799) has the molecular formula C52H48N4O8+4 and a molecular weight of 856.98 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,6-dimethoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium.
| Compound Name | 5,10,15,20-tetrakis(2,6-dimethoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium |
|---|---|
| PubChem CID | 139073799 |
| Molecular Formula | C52H48N4O8+4 |
| Molecular Weight | 856.98 g/mol |
| Exact Mass | 856.35 |
| IUPAC Name | 5,10,15,20-tetrakis(2,6-dimethoxyphenyl)-21,22,23,24-tetrahydroporphyrin-5,10,15,20-tetraylium |
| SMILES | COc1cccc(OC)c1[C+]1c2ccc([nH]2)[C+](c2c(OC)cccc2OC)c2ccc([nH]2)[C+](c2c(OC)cccc2OC)c2ccc([nH]2)[C+](c2c(OC)cccc2OC)c2ccc1[nH]2 |
| InChI | InChI=1S/C52H48N4O8/c1-57-37-13-9-14-38(58-2)49(37)45-29-21-23-31(53-29)46(50-39(59-3)15-10-16-40(50)60-4)33-25-27-35(55-33)48(52-43(63-7)19-12-20-44(52)64-8)36-28-26-34(56-36)47(32-24-22-30(45)54-32)51-41(61-5)17-11-18-42(51)62-6/h9-28,53-56H,1-8H3/q+4 |
| InChIKey | ASBHSPQNPDAASW-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.98 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|