C20H16Br4 — CID 139076148
5,11-bis(2,2-dibromoethenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene (PubChem CID 139076148) has the molecular formula C20H16Br4 and a molecular weight of 575.96 g/mol. Its IUPAC name is 5,11-bis(2,2-dibromoethenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene.
| Compound Name | 5,11-bis(2,2-dibromoethenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
|---|---|
| PubChem CID | 139076148 |
| Molecular Formula | C20H16Br4 |
| Molecular Weight | 575.96 g/mol |
| Exact Mass | 571.80 |
| IUPAC Name | 5,11-bis(2,2-dibromoethenyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
| SMILES | BrC(Br)=Cc1cc2ccc1CCc1ccc(c(C=C(Br)Br)c1)CC2 |
| InChI | InChI=1S/C20H16Br4/c21-19(22)11-17-9-13-1-5-15(17)8-4-14-2-6-16(7-3-13)18(10-14)12-20(23)24/h1-2,5-6,9-12H,3-4,7-8H2 |
| InChIKey | DCVAKCZUKRHCTR-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.96 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |