C19H24N3O+ — CID 139094390
(1S,2S,10R,11R)-11,14,14-trimethyl-5-phenyl-9-oxa-5,6-diaza-3-azoniatetracyclo[9.2.1.02,10.03,7]tetradeca-3,6-diene (PubChem CID 139094390) has the molecular formula C19H24N3O+ and a molecular weight of 310.42 g/mol. Its IUPAC name is (1S,2S,10R,11R)-11,14,14-trimethyl-5-phenyl-9-oxa-5,6-diaza-3-azoniatetracyclo[9.2.1.02,10.03,7]tetradeca-3,6-diene.
| Compound Name | (1S,2S,10R,11R)-11,14,14-trimethyl-5-phenyl-9-oxa-5,6-diaza-3-azoniatetracyclo[9.2.1.02,10.03,7]tetradeca-3,6-diene |
|---|---|
| PubChem CID | 139094390 |
| Molecular Formula | C19H24N3O+ |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (1S,2S,10R,11R)-11,14,14-trimethyl-5-phenyl-9-oxa-5,6-diaza-3-azoniatetracyclo[9.2.1.02,10.03,7]tetradeca-3,6-diene |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H]1OCc3nn(-c4ccccc4)c[n+]3[C@@H]21 |
| InChI | InChI=1S/C19H24N3O/c1-18(2)14-9-10-19(18,3)17-16(14)21-12-22(20-15(21)11-23-17)13-7-5-4-6-8-13/h4-8,12,14,16-17H,9-11H2,1-3H3/q+1/t14-,16+,17+,19+/m1/s1 |
| InChIKey | QOYXZACGEBHHJF-WMEZAQDKSA-N |
| XLogP | 3.06 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|