C27H30N3OSi+ — CID 24998755
[diphenyl-[(5S)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]-trimethylsilane (PubChem CID 24998755) has the molecular formula C27H30N3OSi+ and a molecular weight of 440.64 g/mol. Its IUPAC name is [diphenyl-[(5S)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]-trimethylsilane.
| Compound Name | [diphenyl-[(5S)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 24998755 |
| Molecular Formula | C27H30N3OSi+ |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [diphenyl-[(5S)-2-phenyl-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium-5-yl]methoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1ccccc1)[C@@H]1CCc2nn(-c3ccccc3)c[n+]21 |
| InChI | InChI=1S/C27H30N3OSi/c1-32(2,3)31-27(22-13-7-4-8-14-22,23-15-9-5-10-16-23)25-19-20-26-28-30(21-29(25)26)24-17-11-6-12-18-24/h4-18,21,25H,19-20H2,1-3H3/q+1/t25-/m0/s1 |
| InChIKey | XXOHGCPQJPBIPR-VWLOTQADSA-N |
| XLogP | 5.44 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|