C20H14F12N6 — CID 139135773
N-(1-amino-2,2,2-trifluoroethylidene)-4-(trifluoromethyl)benzenecarboximidamide (PubChem CID 139135773) has the molecular formula C20H14F12N6 and a molecular weight of 566.35 g/mol. Its IUPAC name is N-(1-amino-2,2,2-trifluoroethylidene)-4-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N-(1-amino-2,2,2-trifluoroethylidene)-4-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 139135773 |
| Molecular Formula | C20H14F12N6 |
| Molecular Weight | 566.35 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | N-(1-amino-2,2,2-trifluoroethylidene)-4-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(\N)C(F)(F)F)c1ccc(C(F)(F)F)cc1.[H]/N=C(/N=C(\N)C(F)(F)F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/2C10H7F6N3/c2*11-9(12,13)6-3-1-5(2-4-6)7(17)19-8(18)10(14,15)16/h2*1-4H,(H3,17,18,19) |
| InChIKey | IZUQVMGNYCKQMU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 124.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.35 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|