C12H13F3N4O2 — CID 143076024
methyl N-[2-amino-2-[4-(trifluoromethyl)benzenecarboximidoyl]iminoethyl]carbamate (PubChem CID 143076024) has the molecular formula C12H13F3N4O2 and a molecular weight of 302.26 g/mol. Its IUPAC name is methyl N-[2-amino-2-[4-(trifluoromethyl)benzenecarboximidoyl]iminoethyl]carbamate.
| Compound Name | methyl N-[2-amino-2-[4-(trifluoromethyl)benzenecarboximidoyl]iminoethyl]carbamate |
|---|---|
| PubChem CID | 143076024 |
| Molecular Formula | C12H13F3N4O2 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | methyl N-[2-amino-2-[4-(trifluoromethyl)benzenecarboximidoyl]iminoethyl]carbamate |
| SMILES | [H]/N=C(\N=C(/N)CNC(=O)OC)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N4O2/c1-21-11(20)18-6-9(16)19-10(17)7-2-4-8(5-3-7)12(13,14)15/h2-5H,6H2,1H3,(H,18,20)(H3,16,17,19) |
| InChIKey | JJOUKAXOOCODLD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 100.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|