C27H36IrN3- — CID 139139173
(1Z,5Z)-cycloocta-1,5-diene;[N,N-diethyl-N'-(4-methylphenyl)carbamimidoyl]-(4-methylphenyl)azanide;iridium (PubChem CID 139139173) has the molecular formula C27H36IrN3- and a molecular weight of 594.82 g/mol. Its IUPAC name is (1Z,5Z)-cycloocta-1,5-diene;[N,N-diethyl-N'-(4-methylphenyl)carbamimidoyl]-(4-methylphenyl)azanide;iridium.
| Compound Name | (1Z,5Z)-cycloocta-1,5-diene;[N,N-diethyl-N'-(4-methylphenyl)carbamimidoyl]-(4-methylphenyl)azanide;iridium |
|---|---|
| PubChem CID | 139139173 |
| Molecular Formula | C27H36IrN3- |
| Molecular Weight | 594.82 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (1Z,5Z)-cycloocta-1,5-diene;[N,N-diethyl-N'-(4-methylphenyl)carbamimidoyl]-(4-methylphenyl)azanide;iridium |
| SMILES | C1=C\CC/C=C\CC/1.CCN(CC)/C(=N\c1ccc(C)cc1)[N-]c1ccc(C)cc1.[Ir] |
| InChI | InChI=1S/C19H24N3.C8H12.Ir/c1-5-22(6-2)19(20-17-11-7-15(3)8-12-17)21-18-13-9-16(4)10-14-18;1-2-4-6-8-7-5-3-1;/h7-14H,5-6H2,1-4H3;1-2,7-8H,3-6H2;/q-1;;/b;2-1-,8-7-; |
| InChIKey | HHDGDNDVFZKSJO-GHDUESPLSA-N |
| XLogP | 8.01 |
| TPSA | 29.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.82 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|