C13H11N5S3 — CID 139147649
4-pyridin-4-ylpyridine;1,3,5-triazinane-2,4,6-trithione (PubChem CID 139147649) has the molecular formula C13H11N5S3 and a molecular weight of 333.47 g/mol. Its IUPAC name is 4-pyridin-4-ylpyridine;1,3,5-triazinane-2,4,6-trithione.
| Compound Name | 4-pyridin-4-ylpyridine;1,3,5-triazinane-2,4,6-trithione |
|---|---|
| PubChem CID | 139147649 |
| Molecular Formula | C13H11N5S3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 4-pyridin-4-ylpyridine;1,3,5-triazinane-2,4,6-trithione |
| SMILES | S=c1[nH]c(=S)[nH]c(=S)[nH]1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C3H3N3S3/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;7-1-4-2(8)6-3(9)5-1/h1-8H;(H3,4,5,6,7,8,9) |
| InChIKey | OQCVNYOOFASODO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|