C28H44F3N2O3PS — CID 139172717
1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]azepin-5-ium-10-ylidene-(2,4,6-tritert-butylphenyl)phosphane;trifluoromethanesulfonate (PubChem CID 139172717) has the molecular formula C28H44F3N2O3PS and a molecular weight of 576.71 g/mol. Its IUPAC name is 1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]azepin-5-ium-10-ylidene-(2,4,6-tritert-butylphenyl)phosphane;trifluoromethanesulfonate.
| Compound Name | 1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]azepin-5-ium-10-ylidene-(2,4,6-tritert-butylphenyl)phosphane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139172717 |
| Molecular Formula | C28H44F3N2O3PS |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | 1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]azepin-5-ium-10-ylidene-(2,4,6-tritert-butylphenyl)phosphane;trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=C2\CCCC[N+]3=C2NCCC3)c(C(C)(C)C)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C27H43N2P.CHF3O3S/c1-25(2,3)19-17-20(26(4,5)6)23(21(18-19)27(7,8)9)30-22-13-10-11-15-29-16-12-14-28-24(22)29;2-1(3,4)8(5,6)7/h17-18H,10-16H2,1-9H3;(H,5,6,7) |
| InChIKey | KERXSDWNLCWMRG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|