C6H7N3O3 — CID 139176615
6-[(Z)-2-hydroxyprop-1-enyl]-1H-1,3,5-triazine-2,4-dione (PubChem CID 139176615) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 6-[(Z)-2-hydroxyprop-1-enyl]-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[(Z)-2-hydroxyprop-1-enyl]-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 139176615 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 6-[(Z)-2-hydroxyprop-1-enyl]-1H-1,3,5-triazine-2,4-dione |
| SMILES | C/C(O)=C/c1nc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H7N3O3/c1-3(10)2-4-7-5(11)9-6(12)8-4/h2,10H,1H3,(H2,7,8,9,11,12)/b3-2- |
| InChIKey | DMIOFQFWNBDBII-IHWYPQMZSA-N |
| XLogP | -0.62 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|