C5H7N3O3 — CID 45092655
6-(2-hydroxyethyl)-1H-1,3,5-triazine-2,4-dione (PubChem CID 45092655) has the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. Its IUPAC name is 6-(2-hydroxyethyl)-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-(2-hydroxyethyl)-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 45092655 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 6-(2-hydroxyethyl)-1H-1,3,5-triazine-2,4-dione |
| SMILES | O=c1nc(CCO)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H7N3O3/c9-2-1-3-6-4(10)8-5(11)7-3/h9H,1-2H2,(H2,6,7,8,10,11) |
| InChIKey | CICMENFVVBJQQO-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |