C50H52B2N6O4 — CID 139190156
7-benzyl-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine (PubChem CID 139190156) has the molecular formula C50H52B2N6O4 and a molecular weight of 822.63 g/mol. Its IUPAC name is 7-benzyl-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-benzyl-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 139190156 |
| Molecular Formula | C50H52B2N6O4 |
| Molecular Weight | 822.63 g/mol |
| Exact Mass | 822.42 |
| IUPAC Name | 7-benzyl-4-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine |
| SMILES | CC1(C)OB(c2cc3c(-c4ccccc4)ncnc3n2Cc2ccccc2)OC1(C)C.CC1(C)OB(c2cc3c(-c4ccccc4)ncnc3n2Cc2ccccc2)OC1(C)C |
| InChI | InChI=1S/2C25H26BN3O2/c2*1-24(2)25(3,4)31-26(30-24)21-15-20-22(19-13-9-6-10-14-19)27-17-28-23(20)29(21)16-18-11-7-5-8-12-18/h2*5-15,17H,16H2,1-4H3 |
| InChIKey | RURFEYJBZAFBHL-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.63 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|