C20H22F3NO5 — CID 139192923
diethyl (4R,5Z)-1-acetyl-5-benzylidene-4-(trifluoromethyl)pyrrolidine-2,2-dicarboxylate (PubChem CID 139192923) has the molecular formula C20H22F3NO5 and a molecular weight of 413.39 g/mol. Its IUPAC name is diethyl (4R,5Z)-1-acetyl-5-benzylidene-4-(trifluoromethyl)pyrrolidine-2,2-dicarboxylate.
| Compound Name | diethyl (4R,5Z)-1-acetyl-5-benzylidene-4-(trifluoromethyl)pyrrolidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 139192923 |
| Molecular Formula | C20H22F3NO5 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | diethyl (4R,5Z)-1-acetyl-5-benzylidene-4-(trifluoromethyl)pyrrolidine-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](C(F)(F)F)/C(=C/c2ccccc2)N1C(C)=O |
| InChI | InChI=1S/C20H22F3NO5/c1-4-28-17(26)19(18(27)29-5-2)12-15(20(21,22)23)16(24(19)13(3)25)11-14-9-7-6-8-10-14/h6-11,15H,4-5,12H2,1-3H3/b16-11-/t15-/m1/s1 |
| InChIKey | VWLIQKHXAMVYRX-DFSFMLJYSA-N |
| XLogP | 3.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|