C15H16O5 — CID 139210699
(2E,4Z)-3-[2-(4-hydroxyphenyl)propan-2-yl]hexa-2,4-dienedioic acid (PubChem CID 139210699) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2E,4Z)-3-[2-(4-hydroxyphenyl)propan-2-yl]hexa-2,4-dienedioic acid.
| Compound Name | (2E,4Z)-3-[2-(4-hydroxyphenyl)propan-2-yl]hexa-2,4-dienedioic acid |
|---|---|
| PubChem CID | 139210699 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (2E,4Z)-3-[2-(4-hydroxyphenyl)propan-2-yl]hexa-2,4-dienedioic acid |
| SMILES | CC(C)(C(/C=C\C(=O)O)=C/C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16O5/c1-15(2,10-3-6-12(16)7-4-10)11(9-14(19)20)5-8-13(17)18/h3-9,16H,1-2H3,(H,17,18)(H,19,20)/b8-5-,11-9+ |
| InChIKey | LBVHEPFKFMQALR-TWGJSUAUSA-N |
| XLogP | 2.32 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|