C33H39N3O8 — CID 139212220
[(2S,4R,5R,6S)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methyl N-(3,5-dimethylphenyl)carbamate (PubChem CID 139212220) has the molecular formula C33H39N3O8 and a molecular weight of 605.69 g/mol. Its IUPAC name is [(2S,4R,5R,6S)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methyl N-(3,5-dimethylphenyl)carbamate.
| Compound Name | [(2S,4R,5R,6S)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methyl N-(3,5-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 139212220 |
| Molecular Formula | C33H39N3O8 |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | [(2S,4R,5R,6S)-4,5-bis[(3,5-dimethylphenyl)carbamoyloxy]-6-hydroxyoxan-2-yl]methyl N-(3,5-dimethylphenyl)carbamate |
| SMILES | Cc1cc(C)cc(NC(=O)OC[C@@H]2C[C@@H](OC(=O)Nc3cc(C)cc(C)c3)[C@@H](OC(=O)Nc3cc(C)cc(C)c3)[C@@H](O)O2)c1 |
| InChI | InChI=1S/C33H39N3O8/c1-18-7-19(2)11-24(10-18)34-31(38)41-17-27-16-28(43-32(39)35-25-12-20(3)8-21(4)13-25)29(30(37)42-27)44-33(40)36-26-14-22(5)9-23(6)15-26/h7-15,27-30,37H,16-17H2,1-6H3,(H,34,38)(H,35,39)(H,36,40)/t27-,28+,29+,30-/m0/s1 |
| InChIKey | LKUFYVKGYMNQTJ-KJHMZRPRSA-N |
| XLogP | 6.43 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|