C19H19ClO6 — CID 139223637
diethyl (1S,4aR,9aR)-7-chloro-9-oxo-1,4,4a,9a-tetrahydroxanthene-1,2-dicarboxylate (PubChem CID 139223637) has the molecular formula C19H19ClO6 and a molecular weight of 378.81 g/mol. Its IUPAC name is diethyl (1S,4aR,9aR)-7-chloro-9-oxo-1,4,4a,9a-tetrahydroxanthene-1,2-dicarboxylate.
| Compound Name | diethyl (1S,4aR,9aR)-7-chloro-9-oxo-1,4,4a,9a-tetrahydroxanthene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139223637 |
| Molecular Formula | C19H19ClO6 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | diethyl (1S,4aR,9aR)-7-chloro-9-oxo-1,4,4a,9a-tetrahydroxanthene-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1=CC[C@H]2Oc3ccc(Cl)cc3C(=O)[C@@H]2[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C19H19ClO6/c1-3-24-18(22)11-6-8-14-16(15(11)19(23)25-4-2)17(21)12-9-10(20)5-7-13(12)26-14/h5-7,9,14-16H,3-4,8H2,1-2H3/t14-,15-,16+/m1/s1 |
| InChIKey | UQRAEDJBMMYJHC-OAGGEKHMSA-N |
| XLogP | 2.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |