C20H34Si — CID 139241205
5-butyl-1-[(Z)-hex-1-enyl]-1-hex-1-ynyl-2,3-dihydrosilole (PubChem CID 139241205) has the molecular formula C20H34Si and a molecular weight of 302.58 g/mol. Its IUPAC name is 5-butyl-1-[(Z)-hex-1-enyl]-1-hex-1-ynyl-2,3-dihydrosilole.
| Compound Name | 5-butyl-1-[(Z)-hex-1-enyl]-1-hex-1-ynyl-2,3-dihydrosilole |
|---|---|
| PubChem CID | 139241205 |
| Molecular Formula | C20H34Si |
| Molecular Weight | 302.58 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 5-butyl-1-[(Z)-hex-1-enyl]-1-hex-1-ynyl-2,3-dihydrosilole |
| SMILES | CCCCC#C[Si]1(/C=C\CCCC)CCC=C1CCCC |
| InChI | InChI=1S/C20H34Si/c1-4-7-10-12-17-21(18-13-11-8-5-2)19-14-16-20(21)15-9-6-3/h12,16-17H,4-11,14-15,19H2,1-3H3/b17-12- |
| InChIKey | ZVMQIPJJFDBFIH-ATVHPVEESA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|