C22H17ClFeN2 — CID 139241670
(2-chloro-5-cyclopenta-1,3-dien-1-ylphenyl)-phenyldiazene;cyclopenta-1,3-diene;iron(2+) (PubChem CID 139241670) has the molecular formula C22H17ClFeN2 and a molecular weight of 400.69 g/mol. Its IUPAC name is (2-chloro-5-cyclopenta-1,3-dien-1-ylphenyl)-phenyldiazene;cyclopenta-1,3-diene;iron(2+).
| Compound Name | (2-chloro-5-cyclopenta-1,3-dien-1-ylphenyl)-phenyldiazene;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 139241670 |
| Molecular Formula | C22H17ClFeN2 |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (2-chloro-5-cyclopenta-1,3-dien-1-ylphenyl)-phenyldiazene;cyclopenta-1,3-diene;iron(2+) |
| SMILES | Clc1ccc(-c2ccc[cH-]2)cc1/N=N/c1ccccc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C17H12ClN2.C5H5.Fe/c18-16-11-10-14(13-6-4-5-7-13)12-17(16)20-19-15-8-2-1-3-9-15;1-2-4-5-3-1;/h1-12H;1-5H;/q2*-1;+2/b20-19+;; |
| InChIKey | RFUCVIVCUUSOQW-LLIZZRELSA-N |
| XLogP | 7.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|