C22H24F3NO — CID 139250971
[(E)-6-phenylhex-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate (PubChem CID 139250971) has the molecular formula C22H24F3NO and a molecular weight of 375.43 g/mol. Its IUPAC name is [(E)-6-phenylhex-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate.
| Compound Name | [(E)-6-phenylhex-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
|---|---|
| PubChem CID | 139250971 |
| Molecular Formula | C22H24F3NO |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [(E)-6-phenylhex-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
| SMILES | CC(/C=C/CCc1ccccc1)O/C(=N/CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H24F3NO/c1-18(10-8-9-15-19-11-4-2-5-12-19)27-21(22(23,24)25)26-17-16-20-13-6-3-7-14-20/h2-8,10-14,18H,9,15-17H2,1H3/b10-8+,26-21+ |
| InChIKey | JCJAUOHNGRYXBI-BGUXHRGTSA-N |
| XLogP | 5.78 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|