C14H25NO4S2 — CID 139260468
(4R,5R)-5-[(R)-1,3-dithian-2-yl(methoxy)methyl]-N,N,2,2-tetramethyl-1,3-dioxolane-4-carboxamide (PubChem CID 139260468) has the molecular formula C14H25NO4S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is (4R,5R)-5-[(R)-1,3-dithian-2-yl(methoxy)methyl]-N,N,2,2-tetramethyl-1,3-dioxolane-4-carboxamide.
| Compound Name | (4R,5R)-5-[(R)-1,3-dithian-2-yl(methoxy)methyl]-N,N,2,2-tetramethyl-1,3-dioxolane-4-carboxamide |
|---|---|
| PubChem CID | 139260468 |
| Molecular Formula | C14H25NO4S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (4R,5R)-5-[(R)-1,3-dithian-2-yl(methoxy)methyl]-N,N,2,2-tetramethyl-1,3-dioxolane-4-carboxamide |
| SMILES | CO[C@@H](C1SCCCS1)[C@@H]1OC(C)(C)O[C@H]1C(=O)N(C)C |
| InChI | InChI=1S/C14H25NO4S2/c1-14(2)18-9(10(19-14)12(16)15(3)4)11(17-5)13-20-7-6-8-21-13/h9-11,13H,6-8H2,1-5H3/t9-,10-,11-/m1/s1 |
| InChIKey | NHOSMZVYRWQIKH-GMTAPVOTSA-N |
| XLogP | 1.81 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |