C20H23F3N4S — CID 139346707
3-[3-piperazin-1-yl-7-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine (PubChem CID 139346707) has the molecular formula C20H23F3N4S and a molecular weight of 408.49 g/mol. Its IUPAC name is 3-[3-piperazin-1-yl-7-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine.
| Compound Name | 3-[3-piperazin-1-yl-7-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine |
|---|---|
| PubChem CID | 139346707 |
| Molecular Formula | C20H23F3N4S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 3-[3-piperazin-1-yl-7-(trifluoromethyl)phenothiazin-10-yl]propan-1-amine |
| SMILES | NCCCN1c2ccc(N3CCNCC3)cc2Sc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H23F3N4S/c21-20(22,23)14-2-4-16-18(12-14)28-19-13-15(26-10-7-25-8-11-26)3-5-17(19)27(16)9-1-6-24/h2-5,12-13,25H,1,6-11,24H2 |
| InChIKey | YWJWGMJLHPMCGA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |