C19H29N — CID 139352388
N-ethenyl-3-(2-ethyl-3-methylbut-3-enyl)-N,2,4,6-tetramethylaniline (PubChem CID 139352388) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is N-ethenyl-3-(2-ethyl-3-methylbut-3-enyl)-N,2,4,6-tetramethylaniline.
| Compound Name | N-ethenyl-3-(2-ethyl-3-methylbut-3-enyl)-N,2,4,6-tetramethylaniline |
|---|---|
| PubChem CID | 139352388 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-ethenyl-3-(2-ethyl-3-methylbut-3-enyl)-N,2,4,6-tetramethylaniline |
| SMILES | C=CN(C)c1c(C)cc(C)c(CC(CC)C(=C)C)c1C |
| InChI | InChI=1S/C19H29N/c1-9-17(13(3)4)12-18-14(5)11-15(6)19(16(18)7)20(8)10-2/h10-11,17H,2-3,9,12H2,1,4-8H3 |
| InChIKey | AXAKMWCACDBADW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|