C17H34O6 — CID 139436783
(2,3-dimethyl-3-propan-2-yloxybutan-2-yl) 2-(3-hydroxy-3-methylbutoxy)ethyl carbonate (PubChem CID 139436783) has the molecular formula C17H34O6 and a molecular weight of 334.45 g/mol. Its IUPAC name is (2,3-dimethyl-3-propan-2-yloxybutan-2-yl) 2-(3-hydroxy-3-methylbutoxy)ethyl carbonate.
| Compound Name | (2,3-dimethyl-3-propan-2-yloxybutan-2-yl) 2-(3-hydroxy-3-methylbutoxy)ethyl carbonate |
|---|---|
| PubChem CID | 139436783 |
| Molecular Formula | C17H34O6 |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (2,3-dimethyl-3-propan-2-yloxybutan-2-yl) 2-(3-hydroxy-3-methylbutoxy)ethyl carbonate |
| SMILES | CC(C)OC(C)(C)C(C)(C)OC(=O)OCCOCCC(C)(C)O |
| InChI | InChI=1S/C17H34O6/c1-13(2)22-16(5,6)17(7,8)23-14(18)21-12-11-20-10-9-15(3,4)19/h13,19H,9-12H2,1-8H3 |
| InChIKey | KHRVFAYNZSIWMP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|