C23H14N2O2S — CID 139448171
7-methyl-14λ6-thia-13,15-diazahexacyclo[15.8.0.02,11.05,10.012,16.018,23]pentacosa-1(17),2(11),3,5(10),6,8,12,15,18,20,22,24-dodecaene 14,14-dioxide (PubChem CID 139448171) has the molecular formula C23H14N2O2S and a molecular weight of 382.44 g/mol. Its IUPAC name is 7-methyl-14λ6-thia-13,15-diazahexacyclo[15.8.0.02,11.05,10.012,16.018,23]pentacosa-1(17),2(11),3,5(10),6,8,12,15,18,20,22,24-dodecaene 14,14-dioxide.
| Compound Name | 7-methyl-14λ6-thia-13,15-diazahexacyclo[15.8.0.02,11.05,10.012,16.018,23]pentacosa-1(17),2(11),3,5(10),6,8,12,15,18,20,22,24-dodecaene 14,14-dioxide |
|---|---|
| PubChem CID | 139448171 |
| Molecular Formula | C23H14N2O2S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 7-methyl-14λ6-thia-13,15-diazahexacyclo[15.8.0.02,11.05,10.012,16.018,23]pentacosa-1(17),2(11),3,5(10),6,8,12,15,18,20,22,24-dodecaene 14,14-dioxide |
| SMILES | Cc1ccc2c(ccc3c4ccc5ccccc5c4c4c(c23)=NS(=O)(=O)N=4)c1 |
| InChI | InChI=1S/C23H14N2O2S/c1-13-6-9-17-15(12-13)8-11-19-18-10-7-14-4-2-3-5-16(14)20(18)22-23(21(17)19)25-28(26,27)24-22/h2-12H,1H3 |
| InChIKey | DDLDEAUVVCLORR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|