C20H19Cl4N — CID 139448418
(3Z,5Z)-3-[(2E,4Z)-4,5-dichloro-2-methylhexa-2,4-dienylidene]-5-[(3,4-dichlorophenyl)methylidene]-4-methylidenepiperidine (PubChem CID 139448418) has the molecular formula C20H19Cl4N and a molecular weight of 415.19 g/mol. Its IUPAC name is (3Z,5Z)-3-[(2E,4Z)-4,5-dichloro-2-methylhexa-2,4-dienylidene]-5-[(3,4-dichlorophenyl)methylidene]-4-methylidenepiperidine.
| Compound Name | (3Z,5Z)-3-[(2E,4Z)-4,5-dichloro-2-methylhexa-2,4-dienylidene]-5-[(3,4-dichlorophenyl)methylidene]-4-methylidenepiperidine |
|---|---|
| PubChem CID | 139448418 |
| Molecular Formula | C20H19Cl4N |
| Molecular Weight | 415.19 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | (3Z,5Z)-3-[(2E,4Z)-4,5-dichloro-2-methylhexa-2,4-dienylidene]-5-[(3,4-dichlorophenyl)methylidene]-4-methylidenepiperidine |
| SMILES | C=C1/C(=C/C(C)=C/C(Cl)=C(\C)Cl)CNC/C1=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H19Cl4N/c1-12(7-19(23)14(3)21)6-16-10-25-11-17(13(16)2)8-15-4-5-18(22)20(24)9-15/h4-9,25H,2,10-11H2,1,3H3/b12-7+,16-6+,17-8+,19-14- |
| InChIKey | TYVHTTXMWWARMI-UFMVRMOOSA-N |
| XLogP | 7.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.19 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|