C22H25N5O2 — CID 139460674
5-[4-methoxy-5-[3-[(methylideneamino)methyl]phenyl]-2-propan-2-ylphenoxy]pyrimidine-2,4-diamine (PubChem CID 139460674) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 5-[4-methoxy-5-[3-[(methylideneamino)methyl]phenyl]-2-propan-2-ylphenoxy]pyrimidine-2,4-diamine.
| Compound Name | 5-[4-methoxy-5-[3-[(methylideneamino)methyl]phenyl]-2-propan-2-ylphenoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 139460674 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 5-[4-methoxy-5-[3-[(methylideneamino)methyl]phenyl]-2-propan-2-ylphenoxy]pyrimidine-2,4-diamine |
| SMILES | C=NCc1cccc(-c2cc(Oc3cnc(N)nc3N)c(C(C)C)cc2OC)c1 |
| InChI | InChI=1S/C22H25N5O2/c1-13(2)16-9-18(28-4)17(15-7-5-6-14(8-15)11-25-3)10-19(16)29-20-12-26-22(24)27-21(20)23/h5-10,12-13H,3,11H2,1-2,4H3,(H4,23,24,26,27) |
| InChIKey | HISKZZPLOLTGNW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|