C31H35N3O6 — CID 139462542
N-cyclopentyl-3-[5-[7-[2-(dimethylamino)ethoxy]-5-methoxy-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide (PubChem CID 139462542) has the molecular formula C31H35N3O6 and a molecular weight of 545.64 g/mol. Its IUPAC name is N-cyclopentyl-3-[5-[7-[2-(dimethylamino)ethoxy]-5-methoxy-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide.
| Compound Name | N-cyclopentyl-3-[5-[7-[2-(dimethylamino)ethoxy]-5-methoxy-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 139462542 |
| Molecular Formula | C31H35N3O6 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | N-cyclopentyl-3-[5-[7-[2-(dimethylamino)ethoxy]-5-methoxy-9-oxoxanthen-3-yl]oxy-2-pyridinyl]propanamide |
| SMILES | COc1cc(OCCN(C)C)cc2c(=O)c3ccc(Oc4ccc(CCC(=O)NC5CCCC5)nc4)cc3oc12 |
| InChI | InChI=1S/C31H35N3O6/c1-34(2)14-15-38-24-16-26-30(36)25-12-11-22(17-27(25)40-31(26)28(18-24)37-3)39-23-10-8-20(32-19-23)9-13-29(35)33-21-6-4-5-7-21/h8,10-12,16-19,21H,4-7,9,13-15H2,1-3H3,(H,33,35) |
| InChIKey | ZXZUGAJHYNMGOE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|