C21H30F3N5O2 — CID 139481363
[(E)-[(E)-3-amino-2-fluoroprop-2-enylidene]amino] 4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate (PubChem CID 139481363) has the molecular formula C21H30F3N5O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is [(E)-[(E)-3-amino-2-fluoroprop-2-enylidene]amino] 4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate.
| Compound Name | [(E)-[(E)-3-amino-2-fluoroprop-2-enylidene]amino] 4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate |
|---|---|
| PubChem CID | 139481363 |
| Molecular Formula | C21H30F3N5O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | [(E)-[(E)-3-amino-2-fluoroprop-2-enylidene]amino] 4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoate |
| SMILES | N/C=C(F)\C=N\OC(=O)CCCN(CCCCc1ccc2c(n1)NCCC2)CC(F)F |
| InChI | InChI=1S/C21H30F3N5O2/c22-17(13-25)14-27-31-20(30)7-4-12-29(15-19(23)24)11-2-1-6-18-9-8-16-5-3-10-26-21(16)28-18/h8-9,13-14,19H,1-7,10-12,15,25H2,(H,26,28)/b17-13+,27-14+ |
| InChIKey | WAKWFOVEEZYHBO-OVOMSDCHSA-N |
| XLogP | 3.41 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|