C11H18N2O5S — CID 139486710
4-amino-8-(2-amino-2-carboxyethyl)sulfanyl-5-oxooct-7-enoic acid (PubChem CID 139486710) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-amino-8-(2-amino-2-carboxyethyl)sulfanyl-5-oxooct-7-enoic acid.
| Compound Name | 4-amino-8-(2-amino-2-carboxyethyl)sulfanyl-5-oxooct-7-enoic acid |
|---|---|
| PubChem CID | 139486710 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-amino-8-(2-amino-2-carboxyethyl)sulfanyl-5-oxooct-7-enoic acid |
| SMILES | NC(CSC=CCC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18N2O5S/c12-7(3-4-10(15)16)9(14)2-1-5-19-6-8(13)11(17)18/h1,5,7-8H,2-4,6,12-13H2,(H,15,16)(H,17,18) |
| InChIKey | MKFPUMFTDVVYCV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |