C60H72O10 — CID 139527186
10-[4-[4-[3-[4-[11-(4-ethenylphenoxy)-11-oxoundecoxy]phenyl]prop-2-ynoyloxy]phenoxy]carbonylcyclohexyl]oxydecyl 4-ethenylbenzoate (PubChem CID 139527186) has the molecular formula C60H72O10 and a molecular weight of 953.23 g/mol. Its IUPAC name is 10-[4-[4-[3-[4-[11-(4-ethenylphenoxy)-11-oxoundecoxy]phenyl]prop-2-ynoyloxy]phenoxy]carbonylcyclohexyl]oxydecyl 4-ethenylbenzoate.
| Compound Name | 10-[4-[4-[3-[4-[11-(4-ethenylphenoxy)-11-oxoundecoxy]phenyl]prop-2-ynoyloxy]phenoxy]carbonylcyclohexyl]oxydecyl 4-ethenylbenzoate |
|---|---|
| PubChem CID | 139527186 |
| Molecular Formula | C60H72O10 |
| Molecular Weight | 953.23 g/mol |
| Exact Mass | 952.51 |
| IUPAC Name | 10-[4-[4-[3-[4-[11-(4-ethenylphenoxy)-11-oxoundecoxy]phenyl]prop-2-ynoyloxy]phenoxy]carbonylcyclohexyl]oxydecyl 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(OC(=O)CCCCCCCCCCOc2ccc(C#CC(=O)Oc3ccc(OC(=O)C4CCC(OCCCCCCCCCCOC(=O)c5ccc(C=C)cc5)CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C60H72O10/c1-3-47-22-29-50(30-23-47)59(63)67-46-20-16-12-8-7-11-15-19-45-66-53-37-31-51(32-38-53)60(64)70-56-41-39-55(40-42-56)69-58(62)43-28-49-26-33-52(34-27-49)65-44-18-14-10-6-5-9-13-17-21-57(61)68-54-35-24-48(4-2)25-36-54/h3-4,22-27,29-30,33-36,39-42,51,53H,1-2,5-21,31-32,37-38,44-46H2 |
| InChIKey | RRMQHKKHXJOAET-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.23 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|