C42H55NO6 — CID 101027756
[4-[[4-(4-heptoxycyclohexanecarbonyl)oxyphenyl]methylideneamino]phenyl] 4-octoxybenzoate (PubChem CID 101027756) has the molecular formula C42H55NO6 and a molecular weight of 669.90 g/mol. Its IUPAC name is [4-[[4-(4-heptoxycyclohexanecarbonyl)oxyphenyl]methylideneamino]phenyl] 4-octoxybenzoate.
| Compound Name | [4-[[4-(4-heptoxycyclohexanecarbonyl)oxyphenyl]methylideneamino]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 101027756 |
| Molecular Formula | C42H55NO6 |
| Molecular Weight | 669.90 g/mol |
| Exact Mass | 669.40 |
| IUPAC Name | [4-[[4-(4-heptoxycyclohexanecarbonyl)oxyphenyl]methylideneamino]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(/N=C/c3ccc(OC(=O)C4CCC(OCCCCCCC)CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H55NO6/c1-3-5-7-9-11-13-31-47-38-26-18-35(19-27-38)42(45)49-40-28-20-36(21-29-40)43-32-33-14-22-39(23-15-33)48-41(44)34-16-24-37(25-17-34)46-30-12-10-8-6-4-2/h14-15,18-23,26-29,32,34,37H,3-13,16-17,24-25,30-31H2,1-2H3/b43-32+ |
| InChIKey | WEENAXGKIZBJBX-WUGRJRDASA-N |
| XLogP | 10.85 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.90 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|