C29H41ClN6O6 — CID 139540968
(E)-6-(carbamoylamino)-N-[4-(chloromethyl)phenyl]-2-[[(2S)-2-[6-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]hex-3-enamide (PubChem CID 139540968) has the molecular formula C29H41ClN6O6 and a molecular weight of 605.14 g/mol. Its IUPAC name is (E)-6-(carbamoylamino)-N-[4-(chloromethyl)phenyl]-2-[[(2S)-2-[6-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]hex-3-enamide.
| Compound Name | (E)-6-(carbamoylamino)-N-[4-(chloromethyl)phenyl]-2-[[(2S)-2-[6-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]hex-3-enamide |
|---|---|
| PubChem CID | 139540968 |
| Molecular Formula | C29H41ClN6O6 |
| Molecular Weight | 605.14 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | (E)-6-(carbamoylamino)-N-[4-(chloromethyl)phenyl]-2-[[(2S)-2-[6-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)hexanoylamino]-3-methylbutanoyl]amino]hex-3-enamide |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1O)C(=O)NC(/C=C/CCNC(N)=O)C(=O)Nc1ccc(CCl)cc1 |
| InChI | InChI=1S/C29H41ClN6O6/c1-19(2)26(35-23(37)9-4-3-7-17-36-24(38)14-15-25(36)39)28(41)34-22(8-5-6-16-32-29(31)42)27(40)33-21-12-10-20(18-30)11-13-21/h5,8,10-15,19,22,24,26,38H,3-4,6-7,9,16-18H2,1-2H3,(H,33,40)(H,34,41)(H,35,37)(H3,31,32,42)/b8-5+/t22?,24?,26-/m0/s1 |
| InChIKey | DUMRRPYJDXCITG-LPAPWYGYSA-N |
| XLogP | 1.88 |
| TPSA | 182.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.14 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|